C17H12Cl3N3O3 — CID 1386332
2,2,2-trichloro-N-[4-oxo-2-(phenoxymethyl)quinazolin-3-yl]acetamide (PubChem CID 1386332) has the molecular formula C17H12Cl3N3O3 and a molecular weight of 412.66 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[4-oxo-2-(phenoxymethyl)quinazolin-3-yl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[4-oxo-2-(phenoxymethyl)quinazolin-3-yl]acetamide |
|---|---|
| PubChem CID | 1386332 |
| Molecular Formula | C17H12Cl3N3O3 |
| Molecular Weight | 412.66 g/mol |
| Exact Mass | 410.99 |
| IUPAC Name | 2,2,2-trichloro-N-[4-oxo-2-(phenoxymethyl)quinazolin-3-yl]acetamide |
| SMILES | O=C(Nn1c(COc2ccccc2)nc2ccccc2c1=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C17H12Cl3N3O3/c18-17(19,20)16(25)22-23-14(10-26-11-6-2-1-3-7-11)21-13-9-5-4-8-12(13)15(23)24/h1-9H,10H2,(H,22,25) |
| InChIKey | XRIGPWYPAMUKOE-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.66 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|