C25H30N2O2 — CID 71765317
N,N-dimethyl-4-[(E)-2-[6-[(1-methylpiperidin-3-yl)methoxy]-1-benzofuran-2-yl]ethenyl]aniline (PubChem CID 71765317) has the molecular formula C25H30N2O2 and a molecular weight of 390.53 g/mol. Its IUPAC name is N,N-dimethyl-4-[(E)-2-[6-[(1-methylpiperidin-3-yl)methoxy]-1-benzofuran-2-yl]ethenyl]aniline.
| Compound Name | N,N-dimethyl-4-[(E)-2-[6-[(1-methylpiperidin-3-yl)methoxy]-1-benzofuran-2-yl]ethenyl]aniline |
|---|---|
| PubChem CID | 71765317 |
| Molecular Formula | C25H30N2O2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | N,N-dimethyl-4-[(E)-2-[6-[(1-methylpiperidin-3-yl)methoxy]-1-benzofuran-2-yl]ethenyl]aniline |
| SMILES | CN1CCCC(COc2ccc3cc(/C=C/c4ccc(N(C)C)cc4)oc3c2)C1 |
| InChI | InChI=1S/C25H30N2O2/c1-26(2)22-10-6-19(7-11-22)8-12-24-15-21-9-13-23(16-25(21)29-24)28-18-20-5-4-14-27(3)17-20/h6-13,15-16,20H,4-5,14,17-18H2,1-3H3/b12-8+ |
| InChIKey | KXQGDFHYDZNJTP-XYOKQWHBSA-N |
| XLogP | 5.39 |
| TPSA | 28.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|