C22H22N4O — CID 71767413
3-[2-(3-cyanophenyl)ethynyl]-N,N-diethyl-7,8-dihydro-5H-1,6-naphthyridine-6-carboxamide (PubChem CID 71767413) has the molecular formula C22H22N4O and a molecular weight of 358.45 g/mol. Its IUPAC name is 3-[2-(3-cyanophenyl)ethynyl]-N,N-diethyl-7,8-dihydro-5H-1,6-naphthyridine-6-carboxamide.
| Compound Name | 3-[2-(3-cyanophenyl)ethynyl]-N,N-diethyl-7,8-dihydro-5H-1,6-naphthyridine-6-carboxamide |
|---|---|
| PubChem CID | 71767413 |
| Molecular Formula | C22H22N4O |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 3-[2-(3-cyanophenyl)ethynyl]-N,N-diethyl-7,8-dihydro-5H-1,6-naphthyridine-6-carboxamide |
| SMILES | CCN(CC)C(=O)N1CCc2ncc(C#Cc3cccc(C#N)c3)cc2C1 |
| InChI | InChI=1S/C22H22N4O/c1-3-25(4-2)22(27)26-11-10-21-20(16-26)13-19(15-24-21)9-8-17-6-5-7-18(12-17)14-23/h5-7,12-13,15H,3-4,10-11,16H2,1-2H3 |
| InChIKey | YYVCBPHQIJYBJZ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 60.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|