C20H24N4O2 — CID 156692775
N,N-diethyl-3-[2-(3-methoxyphenyl)ethynyl]-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-7-carboxamide (PubChem CID 156692775) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is N,N-diethyl-3-[2-(3-methoxyphenyl)ethynyl]-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-7-carboxamide.
| Compound Name | N,N-diethyl-3-[2-(3-methoxyphenyl)ethynyl]-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 156692775 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | N,N-diethyl-3-[2-(3-methoxyphenyl)ethynyl]-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-7-carboxamide |
| SMILES | CCN(CC)C(=O)N1CCn2c(C#Cc3cccc(OC)c3)cnc2C1 |
| InChI | InChI=1S/C20H24N4O2/c1-4-22(5-2)20(25)23-11-12-24-17(14-21-19(24)15-23)10-9-16-7-6-8-18(13-16)26-3/h6-8,13-14H,4-5,11-12,15H2,1-3H3 |
| InChIKey | BUUWCVOHEYSOPM-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|