C14H5Cl4FN2O4S — CID 71770182
3-fluoro-4-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)benzenesulfonamide (PubChem CID 71770182) has the molecular formula C14H5Cl4FN2O4S and a molecular weight of 458.08 g/mol. Its IUPAC name is 3-fluoro-4-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)benzenesulfonamide.
| Compound Name | 3-fluoro-4-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 71770182 |
| Molecular Formula | C14H5Cl4FN2O4S |
| Molecular Weight | 458.08 g/mol |
| Exact Mass | 455.87 |
| IUPAC Name | 3-fluoro-4-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(N2C(=O)c3c(Cl)c(Cl)c(Cl)c(Cl)c3C2=O)c(F)c1 |
| InChI | InChI=1S/C14H5Cl4FN2O4S/c15-9-7-8(10(16)12(18)11(9)17)14(23)21(13(7)22)6-2-1-4(3-5(6)19)26(20,24)25/h1-3H,(H2,20,24,25) |
| InChIKey | LOAOSOPCDWHXJF-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.08 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|