C14H6Cl4N2O4S — CID 71770181
2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)benzenesulfonamide (PubChem CID 71770181) has the molecular formula C14H6Cl4N2O4S and a molecular weight of 440.09 g/mol. Its IUPAC name is 2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)benzenesulfonamide.
| Compound Name | 2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 71770181 |
| Molecular Formula | C14H6Cl4N2O4S |
| Molecular Weight | 440.09 g/mol |
| Exact Mass | 437.88 |
| IUPAC Name | 2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccccc1N1C(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c2C1=O |
| InChI | InChI=1S/C14H6Cl4N2O4S/c15-9-7-8(10(16)12(18)11(9)17)14(22)20(13(7)21)5-3-1-2-4-6(5)25(19,23)24/h1-4H,(H2,19,23,24) |
| InChIKey | VQYXZRNYNPACLO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.09 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|