C16H10Cl4N2O4S — CID 71770179
4-[2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)ethyl]benzenesulfonamide (PubChem CID 71770179) has the molecular formula C16H10Cl4N2O4S and a molecular weight of 468.15 g/mol. Its IUPAC name is 4-[2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)ethyl]benzenesulfonamide.
| Compound Name | 4-[2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 71770179 |
| Molecular Formula | C16H10Cl4N2O4S |
| Molecular Weight | 468.15 g/mol |
| Exact Mass | 465.91 |
| IUPAC Name | 4-[2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)ethyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CCN2C(=O)c3c(Cl)c(Cl)c(Cl)c(Cl)c3C2=O)cc1 |
| InChI | InChI=1S/C16H10Cl4N2O4S/c17-11-9-10(12(18)14(20)13(11)19)16(24)22(15(9)23)6-5-7-1-3-8(4-2-7)27(21,25)26/h1-4H,5-6H2,(H2,21,25,26) |
| InChIKey | GNOITBWORAUPOH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.15 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|