C15H7Cl4NO2 — CID 983732
2-benzyl-4,5,6,7-tetrachloroisoindole-1,3-dione (PubChem CID 983732) has the molecular formula C15H7Cl4NO2 and a molecular weight of 375.04 g/mol. Its IUPAC name is 2-benzyl-4,5,6,7-tetrachloroisoindole-1,3-dione.
| Compound Name | 2-benzyl-4,5,6,7-tetrachloroisoindole-1,3-dione |
|---|---|
| PubChem CID | 983732 |
| Molecular Formula | C15H7Cl4NO2 |
| Molecular Weight | 375.04 g/mol |
| Exact Mass | 372.92 |
| IUPAC Name | 2-benzyl-4,5,6,7-tetrachloroisoindole-1,3-dione |
| SMILES | O=C1c2c(Cl)c(Cl)c(Cl)c(Cl)c2C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C15H7Cl4NO2/c16-10-8-9(11(17)13(19)12(10)18)15(22)20(14(8)21)6-7-4-2-1-3-5-7/h1-5H,6H2 |
| InChIKey | MQFQHWBPMPPVNJ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.04 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|