C14H5Cl5N2O4S — CID 71770183
3-chloro-4-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)benzenesulfonamide (PubChem CID 71770183) has the molecular formula C14H5Cl5N2O4S and a molecular weight of 474.54 g/mol. Its IUPAC name is 3-chloro-4-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)benzenesulfonamide.
| Compound Name | 3-chloro-4-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 71770183 |
| Molecular Formula | C14H5Cl5N2O4S |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 471.84 |
| IUPAC Name | 3-chloro-4-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(N2C(=O)c3c(Cl)c(Cl)c(Cl)c(Cl)c3C2=O)c(Cl)c1 |
| InChI | InChI=1S/C14H5Cl5N2O4S/c15-5-3-4(26(20,24)25)1-2-6(5)21-13(22)7-8(14(21)23)10(17)12(19)11(18)9(7)16/h1-3H,(H2,20,24,25) |
| InChIKey | OOXGTQNRDBHNEC-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|