C15H12N2O6 — CID 7177048
(3aS,4S,7R,7aR)-2-[(4-nitrophenyl)methoxy]-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 7177048) has the molecular formula C15H12N2O6 and a molecular weight of 316.27 g/mol. Its IUPAC name is (3aS,4S,7R,7aR)-2-[(4-nitrophenyl)methoxy]-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (3aS,4S,7R,7aR)-2-[(4-nitrophenyl)methoxy]-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 7177048 |
| Molecular Formula | C15H12N2O6 |
| Molecular Weight | 316.27 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | (3aS,4S,7R,7aR)-2-[(4-nitrophenyl)methoxy]-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | O=C1[C@@H]2[C@H](C(=O)N1OCc1ccc([N+](=O)[O-])cc1)[C@@H]1C=C[C@H]2O1 |
| InChI | InChI=1S/C15H12N2O6/c18-14-12-10-5-6-11(23-10)13(12)15(19)16(14)22-7-8-1-3-9(4-2-8)17(20)21/h1-6,10-13H,7H2/t10-,11+,12+,13- |
| InChIKey | DXDZEWCKZWYYFF-FNFFVJSTSA-N |
| XLogP | 0.96 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.27 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|