C8H8ClN3 — CID 71773258
2-(4-chloro-1,2-dihydroimidazol-3-yl)pyridine (PubChem CID 71773258) has the molecular formula C8H8ClN3 and a molecular weight of 181.63 g/mol. Its IUPAC name is 2-(4-chloro-1,2-dihydroimidazol-3-yl)pyridine.
| Compound Name | 2-(4-chloro-1,2-dihydroimidazol-3-yl)pyridine |
|---|---|
| PubChem CID | 71773258 |
| Molecular Formula | C8H8ClN3 |
| Molecular Weight | 181.63 g/mol |
| Exact Mass | 181.04 |
| IUPAC Name | 2-(4-chloro-1,2-dihydroimidazol-3-yl)pyridine |
| SMILES | ClC1=CNCN1c1ccccn1 |
| InChI | InChI=1S/C8H8ClN3/c9-7-5-10-6-12(7)8-3-1-2-4-11-8/h1-5,10H,6H2 |
| InChIKey | PMBMEUFCIOHOHE-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.63 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|