C8H9ClN2O3 — CID 71773610
2-(4-chlorophenyl)-2,2-dihydroxyacetohydrazide (PubChem CID 71773610) has the molecular formula C8H9ClN2O3 and a molecular weight of 216.62 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-2,2-dihydroxyacetohydrazide.
| Compound Name | 2-(4-chlorophenyl)-2,2-dihydroxyacetohydrazide |
|---|---|
| PubChem CID | 71773610 |
| Molecular Formula | C8H9ClN2O3 |
| Molecular Weight | 216.62 g/mol |
| Exact Mass | 216.03 |
| IUPAC Name | 2-(4-chlorophenyl)-2,2-dihydroxyacetohydrazide |
| SMILES | NNC(=O)C(O)(O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C8H9ClN2O3/c9-6-3-1-5(2-4-6)8(13,14)7(12)11-10/h1-4,13-14H,10H2,(H,11,12) |
| InChIKey | VABHTWBVQBLZCO-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.62 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|