C14H13ClO2S — CID 71774860
2-[2-[(3-chlorophenyl)methyl]-4-methylthiophen-3-yl]acetic acid (PubChem CID 71774860) has the molecular formula C14H13ClO2S and a molecular weight of 280.78 g/mol. Its IUPAC name is 2-[2-[(3-chlorophenyl)methyl]-4-methylthiophen-3-yl]acetic acid.
| Compound Name | 2-[2-[(3-chlorophenyl)methyl]-4-methylthiophen-3-yl]acetic acid |
|---|---|
| PubChem CID | 71774860 |
| Molecular Formula | C14H13ClO2S |
| Molecular Weight | 280.78 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 2-[2-[(3-chlorophenyl)methyl]-4-methylthiophen-3-yl]acetic acid |
| SMILES | Cc1csc(Cc2cccc(Cl)c2)c1CC(=O)O |
| InChI | InChI=1S/C14H13ClO2S/c1-9-8-18-13(12(9)7-14(16)17)6-10-3-2-4-11(15)5-10/h2-5,8H,6-7H2,1H3,(H,16,17) |
| InChIKey | GXBDTZHYUMURLE-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.78 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |