C16H13ClO3S — CID 59961614
1-[2-[(3-chlorophenyl)methyl]thiophen-3-yl]pentane-1,3,4-trione (PubChem CID 59961614) has the molecular formula C16H13ClO3S and a molecular weight of 320.80 g/mol. Its IUPAC name is 1-[2-[(3-chlorophenyl)methyl]thiophen-3-yl]pentane-1,3,4-trione.
| Compound Name | 1-[2-[(3-chlorophenyl)methyl]thiophen-3-yl]pentane-1,3,4-trione |
|---|---|
| PubChem CID | 59961614 |
| Molecular Formula | C16H13ClO3S |
| Molecular Weight | 320.80 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | 1-[2-[(3-chlorophenyl)methyl]thiophen-3-yl]pentane-1,3,4-trione |
| SMILES | CC(=O)C(=O)CC(=O)c1ccsc1Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H13ClO3S/c1-10(18)14(19)9-15(20)13-5-6-21-16(13)8-11-3-2-4-12(17)7-11/h2-7H,8-9H2,1H3 |
| InChIKey | QCKJFGNPLBRNBJ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.80 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|