C21H23N3O3S — CID 7177555
methyl (4R)-2,7,7-trimethyl-5-oxo-4-(5-thiophen-2-yl-1H-pyrazol-4-yl)-3,4,6,8-tetrahydroquinoline-3-carboxylate (PubChem CID 7177555) has the molecular formula C21H23N3O3S and a molecular weight of 397.50 g/mol. Its IUPAC name is methyl (4R)-2,7,7-trimethyl-5-oxo-4-(5-thiophen-2-yl-1H-pyrazol-4-yl)-3,4,6,8-tetrahydroquinoline-3-carboxylate.
| Compound Name | methyl (4R)-2,7,7-trimethyl-5-oxo-4-(5-thiophen-2-yl-1H-pyrazol-4-yl)-3,4,6,8-tetrahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 7177555 |
| Molecular Formula | C21H23N3O3S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | methyl (4R)-2,7,7-trimethyl-5-oxo-4-(5-thiophen-2-yl-1H-pyrazol-4-yl)-3,4,6,8-tetrahydroquinoline-3-carboxylate |
| SMILES | COC(=O)C1C(C)=NC2=C(C(=O)CC(C)(C)C2)[C@H]1c1cn[nH]c1-c1cccs1 |
| InChI | InChI=1S/C21H23N3O3S/c1-11-16(20(26)27-4)17(12-10-22-24-19(12)15-6-5-7-28-15)18-13(23-11)8-21(2,3)9-14(18)25/h5-7,10,16-17H,8-9H2,1-4H3,(H,22,24)/t16?,17-/m0/s1 |
| InChIKey | PYJCBGYKBDONQQ-DJNXLDHESA-N |
| XLogP | 4.13 |
| TPSA | 84.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |