C23H24FN3O3 — CID 7177563
methyl (4R)-4-[5-(4-fluorophenyl)-1H-pyrazol-4-yl]-2,7,7-trimethyl-5-oxo-3,4,6,8-tetrahydroquinoline-3-carboxylate (PubChem CID 7177563) has the molecular formula C23H24FN3O3 and a molecular weight of 409.46 g/mol. Its IUPAC name is methyl (4R)-4-[5-(4-fluorophenyl)-1H-pyrazol-4-yl]-2,7,7-trimethyl-5-oxo-3,4,6,8-tetrahydroquinoline-3-carboxylate.
| Compound Name | methyl (4R)-4-[5-(4-fluorophenyl)-1H-pyrazol-4-yl]-2,7,7-trimethyl-5-oxo-3,4,6,8-tetrahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 7177563 |
| Molecular Formula | C23H24FN3O3 |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | methyl (4R)-4-[5-(4-fluorophenyl)-1H-pyrazol-4-yl]-2,7,7-trimethyl-5-oxo-3,4,6,8-tetrahydroquinoline-3-carboxylate |
| SMILES | COC(=O)C1C(C)=NC2=C(C(=O)CC(C)(C)C2)[C@H]1c1cn[nH]c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C23H24FN3O3/c1-12-18(22(29)30-4)19(20-16(26-12)9-23(2,3)10-17(20)28)15-11-25-27-21(15)13-5-7-14(24)8-6-13/h5-8,11,18-19H,9-10H2,1-4H3,(H,25,27)/t18?,19-/m0/s1 |
| InChIKey | GIBWLJVXQZDASM-GGYWPGCISA-N |
| XLogP | 4.21 |
| TPSA | 84.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |