C28H34N2O3 — CID 71777174
(2,6-dimethylphenyl) 2-[[(2S,3S,5S)-5-amino-3-hydroxy-1,6-diphenylhexan-2-yl]amino]acetate (PubChem CID 71777174) has the molecular formula C28H34N2O3 and a molecular weight of 446.59 g/mol. Its IUPAC name is (2,6-dimethylphenyl) 2-[[(2S,3S,5S)-5-amino-3-hydroxy-1,6-diphenylhexan-2-yl]amino]acetate.
| Compound Name | (2,6-dimethylphenyl) 2-[[(2S,3S,5S)-5-amino-3-hydroxy-1,6-diphenylhexan-2-yl]amino]acetate |
|---|---|
| PubChem CID | 71777174 |
| Molecular Formula | C28H34N2O3 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.26 |
| IUPAC Name | (2,6-dimethylphenyl) 2-[[(2S,3S,5S)-5-amino-3-hydroxy-1,6-diphenylhexan-2-yl]amino]acetate |
| SMILES | Cc1cccc(C)c1OC(=O)CN[C@@H](Cc1ccccc1)[C@@H](O)C[C@@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C28H34N2O3/c1-20-10-9-11-21(2)28(20)33-27(32)19-30-25(17-23-14-7-4-8-15-23)26(31)18-24(29)16-22-12-5-3-6-13-22/h3-15,24-26,30-31H,16-19,29H2,1-2H3/t24-,25-,26-/m0/s1 |
| InChIKey | JKHIANGKIQUYRJ-GSDHBNRESA-N |
| XLogP | 3.73 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|