C23H29N5O5S2 — CID 71780557
N-(1,3-benzothiazol-2-yl)-2-[4-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]piperazin-1-yl]acetamide;oxalic acid (PubChem CID 71780557) has the molecular formula C23H29N5O5S2 and a molecular weight of 519.65 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-2-[4-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]piperazin-1-yl]acetamide;oxalic acid.
| Compound Name | N-(1,3-benzothiazol-2-yl)-2-[4-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]piperazin-1-yl]acetamide;oxalic acid |
|---|---|
| PubChem CID | 71780557 |
| Molecular Formula | C23H29N5O5S2 |
| Molecular Weight | 519.65 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-2-[4-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]piperazin-1-yl]acetamide;oxalic acid |
| SMILES | CC(C)(C)c1csc(CN2CCN(CC(=O)Nc3nc4ccccc4s3)CC2)n1.O=C(O)C(=O)O |
| InChI | InChI=1S/C21H27N5OS2.C2H2O4/c1-21(2,3)17-14-28-19(23-17)13-26-10-8-25(9-11-26)12-18(27)24-20-22-15-6-4-5-7-16(15)29-20;3-1(4)2(5)6/h4-7,14H,8-13H2,1-3H3,(H,22,24,27);(H,3,4)(H,5,6) |
| InChIKey | MOJVRUCYGVKNGR-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 135.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.65 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|