C23H29F3N4O6S — CID 71780553
2-[4-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]piperazin-1-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide;oxalic acid (PubChem CID 71780553) has the molecular formula C23H29F3N4O6S and a molecular weight of 546.57 g/mol. Its IUPAC name is 2-[4-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]piperazin-1-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide;oxalic acid.
| Compound Name | 2-[4-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]piperazin-1-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide;oxalic acid |
|---|---|
| PubChem CID | 71780553 |
| Molecular Formula | C23H29F3N4O6S |
| Molecular Weight | 546.57 g/mol |
| Exact Mass | 546.18 |
| IUPAC Name | 2-[4-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]piperazin-1-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide;oxalic acid |
| SMILES | CC(C)(C)c1csc(CN2CCN(CC(=O)Nc3ccc(OC(F)(F)F)cc3)CC2)n1.O=C(O)C(=O)O |
| InChI | InChI=1S/C21H27F3N4O2S.C2H2O4/c1-20(2,3)17-14-31-19(26-17)13-28-10-8-27(9-11-28)12-18(29)25-15-4-6-16(7-5-15)30-21(22,23)24;3-1(4)2(5)6/h4-7,14H,8-13H2,1-3H3,(H,25,29);(H,3,4)(H,5,6) |
| InChIKey | WEITXXCCXACZNI-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 132.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.57 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|