C13H12N6O5 — CID 71783954
oxalic acid;2-[3-(3-pyrimidin-2-yl-1,2,4-oxadiazol-5-yl)azetidin-1-yl]acetonitrile (PubChem CID 71783954) has the molecular formula C13H12N6O5 and a molecular weight of 332.28 g/mol. Its IUPAC name is oxalic acid;2-[3-(3-pyrimidin-2-yl-1,2,4-oxadiazol-5-yl)azetidin-1-yl]acetonitrile.
| Compound Name | oxalic acid;2-[3-(3-pyrimidin-2-yl-1,2,4-oxadiazol-5-yl)azetidin-1-yl]acetonitrile |
|---|---|
| PubChem CID | 71783954 |
| Molecular Formula | C13H12N6O5 |
| Molecular Weight | 332.28 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | oxalic acid;2-[3-(3-pyrimidin-2-yl-1,2,4-oxadiazol-5-yl)azetidin-1-yl]acetonitrile |
| SMILES | N#CCN1CC(c2nc(-c3ncccn3)no2)C1.O=C(O)C(=O)O |
| InChI | InChI=1S/C11H10N6O.C2H2O4/c12-2-5-17-6-8(7-17)11-15-10(16-18-11)9-13-3-1-4-14-9;3-1(4)2(5)6/h1,3-4,8H,5-7H2;(H,3,4)(H,5,6) |
| InChIKey | GRLLDIFRTQYSAB-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 166.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.28 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|