C24H27N2O3+ — CID 7178406
5-[(1R)-1-phenylethoxy]-2-[(4-phenylpiperazin-1-ium-1-yl)methyl]pyran-4-one (PubChem CID 7178406) has the molecular formula C24H27N2O3+ and a molecular weight of 391.49 g/mol. Its IUPAC name is 5-[(1R)-1-phenylethoxy]-2-[(4-phenylpiperazin-1-ium-1-yl)methyl]pyran-4-one.
| Compound Name | 5-[(1R)-1-phenylethoxy]-2-[(4-phenylpiperazin-1-ium-1-yl)methyl]pyran-4-one |
|---|---|
| PubChem CID | 7178406 |
| Molecular Formula | C24H27N2O3+ |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | 5-[(1R)-1-phenylethoxy]-2-[(4-phenylpiperazin-1-ium-1-yl)methyl]pyran-4-one |
| SMILES | C[C@@H](Oc1coc(C[NH+]2CCN(c3ccccc3)CC2)cc1=O)c1ccccc1 |
| InChI | InChI=1S/C24H26N2O3/c1-19(20-8-4-2-5-9-20)29-24-18-28-22(16-23(24)27)17-25-12-14-26(15-13-25)21-10-6-3-7-11-21/h2-11,16,18-19H,12-15,17H2,1H3/p+1/t19-/m1/s1 |
| InChIKey | NHEBIKYUZGAERB-LJQANCHMSA-O |
| XLogP | 2.68 |
| TPSA | 47.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |