C21H25FN3O4+ — CID 7178576
2-[6-[[4-(2-fluorophenyl)piperazin-1-ium-1-yl]methyl]-4-oxopyran-3-yl]oxy-N-prop-2-enylacetamide (PubChem CID 7178576) has the molecular formula C21H25FN3O4+ and a molecular weight of 402.45 g/mol. Its IUPAC name is 2-[6-[[4-(2-fluorophenyl)piperazin-1-ium-1-yl]methyl]-4-oxopyran-3-yl]oxy-N-prop-2-enylacetamide.
| Compound Name | 2-[6-[[4-(2-fluorophenyl)piperazin-1-ium-1-yl]methyl]-4-oxopyran-3-yl]oxy-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 7178576 |
| Molecular Formula | C21H25FN3O4+ |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 2-[6-[[4-(2-fluorophenyl)piperazin-1-ium-1-yl]methyl]-4-oxopyran-3-yl]oxy-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)COc1coc(C[NH+]2CCN(c3ccccc3F)CC2)cc1=O |
| InChI | InChI=1S/C21H24FN3O4/c1-2-7-23-21(27)15-29-20-14-28-16(12-19(20)26)13-24-8-10-25(11-9-24)18-6-4-3-5-17(18)22/h2-6,12,14H,1,7-11,13,15H2,(H,23,27)/p+1 |
| InChIKey | VZADAAUFQWKJON-UHFFFAOYSA-O |
| XLogP | 0.37 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|