C22H27FN2O5 — CID 7178499
(2R)-2-[6-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-4-oxopyran-3-yl]oxyhexanoic acid (PubChem CID 7178499) has the molecular formula C22H27FN2O5 and a molecular weight of 418.47 g/mol. Its IUPAC name is (2R)-2-[6-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-4-oxopyran-3-yl]oxyhexanoic acid.
| Compound Name | (2R)-2-[6-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-4-oxopyran-3-yl]oxyhexanoic acid |
|---|---|
| PubChem CID | 7178499 |
| Molecular Formula | C22H27FN2O5 |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | (2R)-2-[6-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-4-oxopyran-3-yl]oxyhexanoic acid |
| SMILES | CCCC[C@@H](Oc1coc(CN2CCN(c3ccccc3F)CC2)cc1=O)C(=O)O |
| InChI | InChI=1S/C22H27FN2O5/c1-2-3-8-20(22(27)28)30-21-15-29-16(13-19(21)26)14-24-9-11-25(12-10-24)18-7-5-4-6-17(18)23/h4-7,13,15,20H,2-3,8-12,14H2,1H3,(H,27,28)/t20-/m1/s1 |
| InChIKey | MQGRTZRCQRKTNO-HXUWFJFHSA-N |
| XLogP | 3.12 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |