C18H21NOS2 — CID 71786987
3-phenylsulfanyl-1-(4-thiophen-3-ylpiperidin-1-yl)propan-1-one (PubChem CID 71786987) has the molecular formula C18H21NOS2 and a molecular weight of 331.51 g/mol. Its IUPAC name is 3-phenylsulfanyl-1-(4-thiophen-3-ylpiperidin-1-yl)propan-1-one.
| Compound Name | 3-phenylsulfanyl-1-(4-thiophen-3-ylpiperidin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 71786987 |
| Molecular Formula | C18H21NOS2 |
| Molecular Weight | 331.51 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 3-phenylsulfanyl-1-(4-thiophen-3-ylpiperidin-1-yl)propan-1-one |
| SMILES | O=C(CCSc1ccccc1)N1CCC(c2ccsc2)CC1 |
| InChI | InChI=1S/C18H21NOS2/c20-18(9-13-22-17-4-2-1-3-5-17)19-10-6-15(7-11-19)16-8-12-21-14-16/h1-5,8,12,14-15H,6-7,9-11,13H2 |
| InChIKey | CNMFNWRWMVVCHZ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.51 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |