C20H30N2OS — CID 97092460
1-[4-[(2S)-2-methylpyrrolidin-1-yl]piperidin-1-yl]-4-phenylsulfanylbutan-1-one (PubChem CID 97092460) has the molecular formula C20H30N2OS and a molecular weight of 346.54 g/mol. Its IUPAC name is 1-[4-[(2S)-2-methylpyrrolidin-1-yl]piperidin-1-yl]-4-phenylsulfanylbutan-1-one.
| Compound Name | 1-[4-[(2S)-2-methylpyrrolidin-1-yl]piperidin-1-yl]-4-phenylsulfanylbutan-1-one |
|---|---|
| PubChem CID | 97092460 |
| Molecular Formula | C20H30N2OS |
| Molecular Weight | 346.54 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | 1-[4-[(2S)-2-methylpyrrolidin-1-yl]piperidin-1-yl]-4-phenylsulfanylbutan-1-one |
| SMILES | C[C@H]1CCCN1C1CCN(C(=O)CCCSc2ccccc2)CC1 |
| InChI | InChI=1S/C20H30N2OS/c1-17-7-5-13-22(17)18-11-14-21(15-12-18)20(23)10-6-16-24-19-8-3-2-4-9-19/h2-4,8-9,17-18H,5-7,10-16H2,1H3/t17-/m0/s1 |
| InChIKey | UCMHGOGSQWASAH-KRWDZBQOSA-N |
| XLogP | 4.03 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.54 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|