C15H17NO3S — CID 71790498
5-(1-thiophen-2-ylcyclopentanecarbonyl)-2-oxa-5-azabicyclo[2.2.1]heptan-3-one (PubChem CID 71790498) has the molecular formula C15H17NO3S and a molecular weight of 291.37 g/mol. Its IUPAC name is 5-(1-thiophen-2-ylcyclopentanecarbonyl)-2-oxa-5-azabicyclo[2.2.1]heptan-3-one.
| Compound Name | 5-(1-thiophen-2-ylcyclopentanecarbonyl)-2-oxa-5-azabicyclo[2.2.1]heptan-3-one |
|---|---|
| PubChem CID | 71790498 |
| Molecular Formula | C15H17NO3S |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 5-(1-thiophen-2-ylcyclopentanecarbonyl)-2-oxa-5-azabicyclo[2.2.1]heptan-3-one |
| SMILES | O=C1OC2CC1N(C(=O)C1(c3cccs3)CCCC1)C2 |
| InChI | InChI=1S/C15H17NO3S/c17-13-11-8-10(19-13)9-16(11)14(18)15(5-1-2-6-15)12-4-3-7-20-12/h3-4,7,10-11H,1-2,5-6,8-9H2 |
| InChIKey | BNKSZEIMLLCMOE-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |