C19H20ClN3O3 — CID 71797324
2-(4-chlorophenoxy)-N-[[5-(furan-2-yl)-1-methylpyrazol-3-yl]methyl]-2-methylpropanamide (PubChem CID 71797324) has the molecular formula C19H20ClN3O3 and a molecular weight of 373.84 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[[5-(furan-2-yl)-1-methylpyrazol-3-yl]methyl]-2-methylpropanamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[[5-(furan-2-yl)-1-methylpyrazol-3-yl]methyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 71797324 |
| Molecular Formula | C19H20ClN3O3 |
| Molecular Weight | 373.84 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[[5-(furan-2-yl)-1-methylpyrazol-3-yl]methyl]-2-methylpropanamide |
| SMILES | Cn1nc(CNC(=O)C(C)(C)Oc2ccc(Cl)cc2)cc1-c1ccco1 |
| InChI | InChI=1S/C19H20ClN3O3/c1-19(2,26-15-8-6-13(20)7-9-15)18(24)21-12-14-11-16(23(3)22-14)17-5-4-10-25-17/h4-11H,12H2,1-3H3,(H,21,24) |
| InChIKey | GXKWGOSUWRYIEJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.84 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |