C20H27ClN2O3 — CID 60595407
2-(4-chlorophenoxy)-N-[2-(diethylamino)-2-(furan-2-yl)ethyl]-2-methylpropanamide (PubChem CID 60595407) has the molecular formula C20H27ClN2O3 and a molecular weight of 378.90 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[2-(diethylamino)-2-(furan-2-yl)ethyl]-2-methylpropanamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[2-(diethylamino)-2-(furan-2-yl)ethyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 60595407 |
| Molecular Formula | C20H27ClN2O3 |
| Molecular Weight | 378.90 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[2-(diethylamino)-2-(furan-2-yl)ethyl]-2-methylpropanamide |
| SMILES | CCN(CC)C(CNC(=O)C(C)(C)Oc1ccc(Cl)cc1)c1ccco1 |
| InChI | InChI=1S/C20H27ClN2O3/c1-5-23(6-2)17(18-8-7-13-25-18)14-22-19(24)20(3,4)26-16-11-9-15(21)10-12-16/h7-13,17H,5-6,14H2,1-4H3,(H,22,24) |
| InChIKey | SYKURUUPOVXMMZ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.90 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |