C16H24BrN3O2S — CID 71806763
4-[[(4-bromothiophene-2-carbonyl)amino]methyl]-N-tert-butylpiperidine-1-carboxamide (PubChem CID 71806763) has the molecular formula C16H24BrN3O2S and a molecular weight of 402.36 g/mol. Its IUPAC name is 4-[[(4-bromothiophene-2-carbonyl)amino]methyl]-N-tert-butylpiperidine-1-carboxamide.
| Compound Name | 4-[[(4-bromothiophene-2-carbonyl)amino]methyl]-N-tert-butylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 71806763 |
| Molecular Formula | C16H24BrN3O2S |
| Molecular Weight | 402.36 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | 4-[[(4-bromothiophene-2-carbonyl)amino]methyl]-N-tert-butylpiperidine-1-carboxamide |
| SMILES | CC(C)(C)NC(=O)N1CCC(CNC(=O)c2cc(Br)cs2)CC1 |
| InChI | InChI=1S/C16H24BrN3O2S/c1-16(2,3)19-15(22)20-6-4-11(5-7-20)9-18-14(21)13-8-12(17)10-23-13/h8,10-11H,4-7,9H2,1-3H3,(H,18,21)(H,19,22) |
| InChIKey | LQQYERRCWNLENO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |