C21H28N6O3 — CID 71807558
N-(4-methoxy-2-methylphenyl)-4-(6-morpholin-4-ylpyridazin-4-yl)piperazine-1-carboxamide (PubChem CID 71807558) has the molecular formula C21H28N6O3 and a molecular weight of 412.49 g/mol. Its IUPAC name is N-(4-methoxy-2-methylphenyl)-4-(6-morpholin-4-ylpyridazin-4-yl)piperazine-1-carboxamide.
| Compound Name | N-(4-methoxy-2-methylphenyl)-4-(6-morpholin-4-ylpyridazin-4-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 71807558 |
| Molecular Formula | C21H28N6O3 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | N-(4-methoxy-2-methylphenyl)-4-(6-morpholin-4-ylpyridazin-4-yl)piperazine-1-carboxamide |
| SMILES | COc1ccc(NC(=O)N2CCN(c3cnnc(N4CCOCC4)c3)CC2)c(C)c1 |
| InChI | InChI=1S/C21H28N6O3/c1-16-13-18(29-2)3-4-19(16)23-21(28)27-7-5-25(6-8-27)17-14-20(24-22-15-17)26-9-11-30-12-10-26/h3-4,13-15H,5-12H2,1-2H3,(H,23,28) |
| InChIKey | LTHUHPTUYSKGRI-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |