C20H24F2N6O3 — CID 122355584
N-[3-(difluoromethoxy)phenyl]-4-(6-morpholin-4-ylpyridazin-4-yl)piperazine-1-carboxamide (PubChem CID 122355584) has the molecular formula C20H24F2N6O3 and a molecular weight of 434.45 g/mol. Its IUPAC name is N-[3-(difluoromethoxy)phenyl]-4-(6-morpholin-4-ylpyridazin-4-yl)piperazine-1-carboxamide.
| Compound Name | N-[3-(difluoromethoxy)phenyl]-4-(6-morpholin-4-ylpyridazin-4-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 122355584 |
| Molecular Formula | C20H24F2N6O3 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | N-[3-(difluoromethoxy)phenyl]-4-(6-morpholin-4-ylpyridazin-4-yl)piperazine-1-carboxamide |
| SMILES | O=C(Nc1cccc(OC(F)F)c1)N1CCN(c2cnnc(N3CCOCC3)c2)CC1 |
| InChI | InChI=1S/C20H24F2N6O3/c21-19(22)31-17-3-1-2-15(12-17)24-20(29)28-6-4-26(5-7-28)16-13-18(25-23-14-16)27-8-10-30-11-9-27/h1-3,12-14,19H,4-11H2,(H,24,29) |
| InChIKey | YPAYEGLNEJVPJR-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |