C20H24FN5O3 — CID 122355627
2-(4-fluorophenoxy)-1-[4-(6-morpholin-4-ylpyridazin-4-yl)piperazin-1-yl]ethanone (PubChem CID 122355627) has the molecular formula C20H24FN5O3 and a molecular weight of 401.44 g/mol. Its IUPAC name is 2-(4-fluorophenoxy)-1-[4-(6-morpholin-4-ylpyridazin-4-yl)piperazin-1-yl]ethanone.
| Compound Name | 2-(4-fluorophenoxy)-1-[4-(6-morpholin-4-ylpyridazin-4-yl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 122355627 |
| Molecular Formula | C20H24FN5O3 |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 2-(4-fluorophenoxy)-1-[4-(6-morpholin-4-ylpyridazin-4-yl)piperazin-1-yl]ethanone |
| SMILES | O=C(COc1ccc(F)cc1)N1CCN(c2cnnc(N3CCOCC3)c2)CC1 |
| InChI | InChI=1S/C20H24FN5O3/c21-16-1-3-18(4-2-16)29-15-20(27)26-7-5-24(6-8-26)17-13-19(23-22-14-17)25-9-11-28-12-10-25/h1-4,13-14H,5-12,15H2 |
| InChIKey | STCGMELFLNQKSS-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 71.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |