C21H27N5O3 — CID 122355625
2-(4-methylphenoxy)-1-[4-(6-morpholin-4-ylpyridazin-4-yl)piperazin-1-yl]ethanone (PubChem CID 122355625) has the molecular formula C21H27N5O3 and a molecular weight of 397.48 g/mol. Its IUPAC name is 2-(4-methylphenoxy)-1-[4-(6-morpholin-4-ylpyridazin-4-yl)piperazin-1-yl]ethanone.
| Compound Name | 2-(4-methylphenoxy)-1-[4-(6-morpholin-4-ylpyridazin-4-yl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 122355625 |
| Molecular Formula | C21H27N5O3 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | 2-(4-methylphenoxy)-1-[4-(6-morpholin-4-ylpyridazin-4-yl)piperazin-1-yl]ethanone |
| SMILES | Cc1ccc(OCC(=O)N2CCN(c3cnnc(N4CCOCC4)c3)CC2)cc1 |
| InChI | InChI=1S/C21H27N5O3/c1-17-2-4-19(5-3-17)29-16-21(27)26-8-6-24(7-9-26)18-14-20(23-22-15-18)25-10-12-28-13-11-25/h2-5,14-15H,6-13,16H2,1H3 |
| InChIKey | MVAHSEACSTVYQH-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 71.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |