C22H21F2N3O3S — CID 71808815
2-[4-(4-fluorophenyl)pyrazol-1-yl]-1-[4-(4-fluorophenyl)sulfonylpiperidin-1-yl]ethanone (PubChem CID 71808815) has the molecular formula C22H21F2N3O3S and a molecular weight of 445.49 g/mol. Its IUPAC name is 2-[4-(4-fluorophenyl)pyrazol-1-yl]-1-[4-(4-fluorophenyl)sulfonylpiperidin-1-yl]ethanone.
| Compound Name | 2-[4-(4-fluorophenyl)pyrazol-1-yl]-1-[4-(4-fluorophenyl)sulfonylpiperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 71808815 |
| Molecular Formula | C22H21F2N3O3S |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | 2-[4-(4-fluorophenyl)pyrazol-1-yl]-1-[4-(4-fluorophenyl)sulfonylpiperidin-1-yl]ethanone |
| SMILES | O=C(Cn1cc(-c2ccc(F)cc2)cn1)N1CCC(S(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C22H21F2N3O3S/c23-18-3-1-16(2-4-18)17-13-25-27(14-17)15-22(28)26-11-9-21(10-12-26)31(29,30)20-7-5-19(24)6-8-20/h1-8,13-14,21H,9-12,15H2 |
| InChIKey | IAJKENXZQUHLOY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |