C18H29BrN3O5P — CID 71811753
3-[[(2S,3S)-2-[(4-bromophenyl)carbamoylamino]-3-methylpentanoyl]amino]pentan-3-ylphosphonic acid (PubChem CID 71811753) has the molecular formula C18H29BrN3O5P and a molecular weight of 478.32 g/mol. Its IUPAC name is 3-[[(2S,3S)-2-[(4-bromophenyl)carbamoylamino]-3-methylpentanoyl]amino]pentan-3-ylphosphonic acid.
| Compound Name | 3-[[(2S,3S)-2-[(4-bromophenyl)carbamoylamino]-3-methylpentanoyl]amino]pentan-3-ylphosphonic acid |
|---|---|
| PubChem CID | 71811753 |
| Molecular Formula | C18H29BrN3O5P |
| Molecular Weight | 478.32 g/mol |
| Exact Mass | 477.10 |
| IUPAC Name | 3-[[(2S,3S)-2-[(4-bromophenyl)carbamoylamino]-3-methylpentanoyl]amino]pentan-3-ylphosphonic acid |
| SMILES | CC[C@H](C)[C@H](NC(=O)Nc1ccc(Br)cc1)C(=O)NC(CC)(CC)P(=O)(O)O |
| InChI | InChI=1S/C18H29BrN3O5P/c1-5-12(4)15(16(23)22-18(6-2,7-3)28(25,26)27)21-17(24)20-14-10-8-13(19)9-11-14/h8-12,15H,5-7H2,1-4H3,(H,22,23)(H2,20,21,24)(H2,25,26,27)/t12-,15-/m0/s1 |
| InChIKey | YSIPLFOWHLWCMU-WFASDCNBSA-N |
| XLogP | 3.80 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.32 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|