C14H18O3 — CID 71813459
(1S,2R,6S,9S)-4,4-dimethyl-3,5-dioxatetracyclo[7.5.0.01,10.02,6]tetradec-7-en-11-one (PubChem CID 71813459) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is (1S,2R,6S,9S)-4,4-dimethyl-3,5-dioxatetracyclo[7.5.0.01,10.02,6]tetradec-7-en-11-one.
| Compound Name | (1S,2R,6S,9S)-4,4-dimethyl-3,5-dioxatetracyclo[7.5.0.01,10.02,6]tetradec-7-en-11-one |
|---|---|
| PubChem CID | 71813459 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | (1S,2R,6S,9S)-4,4-dimethyl-3,5-dioxatetracyclo[7.5.0.01,10.02,6]tetradec-7-en-11-one |
| SMILES | CC1(C)O[C@H]2C=C[C@H]3C4C(=O)CCC[C@@]43[C@H]2O1 |
| InChI | InChI=1S/C14H18O3/c1-13(2)16-10-6-5-8-11-9(15)4-3-7-14(8,11)12(10)17-13/h5-6,8,10-12H,3-4,7H2,1-2H3/t8-,10-,11?,12-,14-/m0/s1 |
| InChIKey | MDOGILJJYUYWDG-RQTBMDGOSA-N |
| XLogP | 2.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|