C16H23N3O4 — CID 71813991
tert-butyl 4-(4-cyano-2,3-dioxopiperidin-1-yl)piperidine-1-carboxylate (PubChem CID 71813991) has the molecular formula C16H23N3O4 and a molecular weight of 321.38 g/mol. Its IUPAC name is tert-butyl 4-(4-cyano-2,3-dioxopiperidin-1-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-cyano-2,3-dioxopiperidin-1-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71813991 |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | tert-butyl 4-(4-cyano-2,3-dioxopiperidin-1-yl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(N2CCC(C#N)C(=O)C2=O)CC1 |
| InChI | InChI=1S/C16H23N3O4/c1-16(2,3)23-15(22)18-7-5-12(6-8-18)19-9-4-11(10-17)13(20)14(19)21/h11-12H,4-9H2,1-3H3 |
| InChIKey | JYCQABSGPRTULV-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 90.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|