C34H18N8S2 — CID 71815682
2-[5-[5-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)thiophen-2-yl]thiophen-2-yl]-1H-imidazo[4,5-f][1,10]phenanthroline (PubChem CID 71815682) has the molecular formula C34H18N8S2 and a molecular weight of 602.71 g/mol. Its IUPAC name is 2-[5-[5-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)thiophen-2-yl]thiophen-2-yl]-1H-imidazo[4,5-f][1,10]phenanthroline.
| Compound Name | 2-[5-[5-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)thiophen-2-yl]thiophen-2-yl]-1H-imidazo[4,5-f][1,10]phenanthroline |
|---|---|
| PubChem CID | 71815682 |
| Molecular Formula | C34H18N8S2 |
| Molecular Weight | 602.71 g/mol |
| Exact Mass | 602.11 |
| IUPAC Name | 2-[5-[5-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)thiophen-2-yl]thiophen-2-yl]-1H-imidazo[4,5-f][1,10]phenanthroline |
| SMILES | c1cnc2c(c1)c1nc(-c3ccc(-c4ccc(-c5nc6c7cccnc7c7ncccc7c6[nH]5)s4)s3)[nH]c1c1cccnc12 |
| InChI | InChI=1S/C34H18N8S2/c1-5-17-25(35-13-1)26-18(6-2-14-36-26)30-29(17)39-33(40-30)23-11-9-21(43-23)22-10-12-24(44-22)34-41-31-19-7-3-15-37-27(19)28-20(32(31)42-34)8-4-16-38-28/h1-16H,(H,39,40)(H,41,42) |
| InChIKey | IPILAUGTKXNBGM-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.71 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|