C21H18ClF2N3O4 — CID 71815970
(3S)-N-[(3-chloro-2,4-difluorophenyl)methyl]-3-hydroxy-2-oxo-1-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)pyrrolidine-3-carboxamide (PubChem CID 71815970) has the molecular formula C21H18ClF2N3O4 and a molecular weight of 449.84 g/mol. Its IUPAC name is (3S)-N-[(3-chloro-2,4-difluorophenyl)methyl]-3-hydroxy-2-oxo-1-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)pyrrolidine-3-carboxamide.
| Compound Name | (3S)-N-[(3-chloro-2,4-difluorophenyl)methyl]-3-hydroxy-2-oxo-1-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 71815970 |
| Molecular Formula | C21H18ClF2N3O4 |
| Molecular Weight | 449.84 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | (3S)-N-[(3-chloro-2,4-difluorophenyl)methyl]-3-hydroxy-2-oxo-1-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)pyrrolidine-3-carboxamide |
| SMILES | O=C1CCc2cc(N3CC[C@](O)(C(=O)NCc4ccc(F)c(Cl)c4F)C3=O)ccc2N1 |
| InChI | InChI=1S/C21H18ClF2N3O4/c22-17-14(23)4-1-12(18(17)24)10-25-19(29)21(31)7-8-27(20(21)30)13-3-5-15-11(9-13)2-6-16(28)26-15/h1,3-5,9,31H,2,6-8,10H2,(H,25,29)(H,26,28)/t21-/m0/s1 |
| InChIKey | XUXUWHAAFGOLQN-NRFANRHFSA-N |
| XLogP | 2.29 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.84 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|