C23H23FN2O4 — CID 160540138
6-[(3S)-3-[4-(2-fluorophenyl)butanoyl]-3-hydroxy-2-oxopyrrolidin-1-yl]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 160540138) has the molecular formula C23H23FN2O4 and a molecular weight of 410.45 g/mol. Its IUPAC name is 6-[(3S)-3-[4-(2-fluorophenyl)butanoyl]-3-hydroxy-2-oxopyrrolidin-1-yl]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-[(3S)-3-[4-(2-fluorophenyl)butanoyl]-3-hydroxy-2-oxopyrrolidin-1-yl]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 160540138 |
| Molecular Formula | C23H23FN2O4 |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 6-[(3S)-3-[4-(2-fluorophenyl)butanoyl]-3-hydroxy-2-oxopyrrolidin-1-yl]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(N3CC[C@](O)(C(=O)CCCc4ccccc4F)C3=O)ccc2N1 |
| InChI | InChI=1S/C23H23FN2O4/c24-18-6-2-1-4-15(18)5-3-7-20(27)23(30)12-13-26(22(23)29)17-9-10-19-16(14-17)8-11-21(28)25-19/h1-2,4,6,9-10,14,30H,3,5,7-8,11-13H2,(H,25,28)/t23-/m0/s1 |
| InChIKey | QWRFRQPRJCPRDM-QHCPKHFHSA-N |
| XLogP | 2.77 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|