C23H21ClFNO4 — CID 152859975
(3S)-3-[3-(3-chloro-5-fluorophenyl)propanoyl]-3-hydroxy-1-(6-oxo-7,8-dihydro-5H-naphthalen-2-yl)pyrrolidin-2-one (PubChem CID 152859975) has the molecular formula C23H21ClFNO4 and a molecular weight of 429.88 g/mol. Its IUPAC name is (3S)-3-[3-(3-chloro-5-fluorophenyl)propanoyl]-3-hydroxy-1-(6-oxo-7,8-dihydro-5H-naphthalen-2-yl)pyrrolidin-2-one.
| Compound Name | (3S)-3-[3-(3-chloro-5-fluorophenyl)propanoyl]-3-hydroxy-1-(6-oxo-7,8-dihydro-5H-naphthalen-2-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 152859975 |
| Molecular Formula | C23H21ClFNO4 |
| Molecular Weight | 429.88 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | (3S)-3-[3-(3-chloro-5-fluorophenyl)propanoyl]-3-hydroxy-1-(6-oxo-7,8-dihydro-5H-naphthalen-2-yl)pyrrolidin-2-one |
| SMILES | O=C1CCc2cc(N3CC[C@](O)(C(=O)CCc4cc(F)cc(Cl)c4)C3=O)ccc2C1 |
| InChI | InChI=1S/C23H21ClFNO4/c24-17-9-14(10-18(25)13-17)1-6-21(28)23(30)7-8-26(22(23)29)19-4-2-16-12-20(27)5-3-15(16)11-19/h2,4,9-11,13,30H,1,3,5-8,12H2/t23-/m0/s1 |
| InChIKey | TXIJYKFSUZXDAX-QHCPKHFHSA-N |
| XLogP | 3.21 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.88 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|