C20H18ClFN2O4 — CID 161415625
2-[3-[3-(3-chloro-5-fluorophenyl)propanoyl]-3-hydroxy-2-oxopyrrolidin-1-yl]benzamide (PubChem CID 161415625) has the molecular formula C20H18ClFN2O4 and a molecular weight of 404.83 g/mol. Its IUPAC name is 2-[3-[3-(3-chloro-5-fluorophenyl)propanoyl]-3-hydroxy-2-oxopyrrolidin-1-yl]benzamide.
| Compound Name | 2-[3-[3-(3-chloro-5-fluorophenyl)propanoyl]-3-hydroxy-2-oxopyrrolidin-1-yl]benzamide |
|---|---|
| PubChem CID | 161415625 |
| Molecular Formula | C20H18ClFN2O4 |
| Molecular Weight | 404.83 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 2-[3-[3-(3-chloro-5-fluorophenyl)propanoyl]-3-hydroxy-2-oxopyrrolidin-1-yl]benzamide |
| SMILES | NC(=O)c1ccccc1N1CCC(O)(C(=O)CCc2cc(F)cc(Cl)c2)C1=O |
| InChI | InChI=1S/C20H18ClFN2O4/c21-13-9-12(10-14(22)11-13)5-6-17(25)20(28)7-8-24(19(20)27)16-4-2-1-3-15(16)18(23)26/h1-4,9-11,28H,5-8H2,(H2,23,26) |
| InChIKey | VWAVYEMCOBYSRR-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.83 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|