C20H15ClF5NO3 — CID 158673091
(3R)-3-[3-(3-chloro-5-fluorophenyl)propanoyl]-1-[2-fluoro-5-(trifluoromethyl)phenyl]-3-hydroxypyrrolidin-2-one (PubChem CID 158673091) has the molecular formula C20H15ClF5NO3 and a molecular weight of 447.79 g/mol. Its IUPAC name is (3R)-3-[3-(3-chloro-5-fluorophenyl)propanoyl]-1-[2-fluoro-5-(trifluoromethyl)phenyl]-3-hydroxypyrrolidin-2-one.
| Compound Name | (3R)-3-[3-(3-chloro-5-fluorophenyl)propanoyl]-1-[2-fluoro-5-(trifluoromethyl)phenyl]-3-hydroxypyrrolidin-2-one |
|---|---|
| PubChem CID | 158673091 |
| Molecular Formula | C20H15ClF5NO3 |
| Molecular Weight | 447.79 g/mol |
| Exact Mass | 447.07 |
| IUPAC Name | (3R)-3-[3-(3-chloro-5-fluorophenyl)propanoyl]-1-[2-fluoro-5-(trifluoromethyl)phenyl]-3-hydroxypyrrolidin-2-one |
| SMILES | O=C(CCc1cc(F)cc(Cl)c1)[C@]1(O)CCN(c2cc(C(F)(F)F)ccc2F)C1=O |
| InChI | InChI=1S/C20H15ClF5NO3/c21-13-7-11(8-14(22)10-13)1-4-17(28)19(30)5-6-27(18(19)29)16-9-12(20(24,25)26)2-3-15(16)23/h2-3,7-10,30H,1,4-6H2/t19-/m1/s1 |
| InChIKey | IEEPHMDFHBLQAU-LJQANCHMSA-N |
| XLogP | 4.31 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.79 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|