C24H33N3O4 — CID 71816252
ethyl 2-methyl-2-[4-[(5-methyl-2-pyridinyl)carbamoyl-pentylamino]phenoxy]propanoate (PubChem CID 71816252) has the molecular formula C24H33N3O4 and a molecular weight of 427.55 g/mol. Its IUPAC name is ethyl 2-methyl-2-[4-[(5-methyl-2-pyridinyl)carbamoyl-pentylamino]phenoxy]propanoate.
| Compound Name | ethyl 2-methyl-2-[4-[(5-methyl-2-pyridinyl)carbamoyl-pentylamino]phenoxy]propanoate |
|---|---|
| PubChem CID | 71816252 |
| Molecular Formula | C24H33N3O4 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | ethyl 2-methyl-2-[4-[(5-methyl-2-pyridinyl)carbamoyl-pentylamino]phenoxy]propanoate |
| SMILES | CCCCCN(C(=O)Nc1ccc(C)cn1)c1ccc(OC(C)(C)C(=O)OCC)cc1 |
| InChI | InChI=1S/C24H33N3O4/c1-6-8-9-16-27(23(29)26-21-15-10-18(3)17-25-21)19-11-13-20(14-12-19)31-24(4,5)22(28)30-7-2/h10-15,17H,6-9,16H2,1-5H3,(H,25,26,29) |
| InChIKey | CUYGVHXAWUCYKW-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|