C22H31N3O5 — CID 71816248
ethyl 2-methyl-2-[4-[(5-methyl-1,2-oxazol-3-yl)carbamoyl-pentylamino]phenoxy]propanoate (PubChem CID 71816248) has the molecular formula C22H31N3O5 and a molecular weight of 417.51 g/mol. Its IUPAC name is ethyl 2-methyl-2-[4-[(5-methyl-1,2-oxazol-3-yl)carbamoyl-pentylamino]phenoxy]propanoate.
| Compound Name | ethyl 2-methyl-2-[4-[(5-methyl-1,2-oxazol-3-yl)carbamoyl-pentylamino]phenoxy]propanoate |
|---|---|
| PubChem CID | 71816248 |
| Molecular Formula | C22H31N3O5 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | ethyl 2-methyl-2-[4-[(5-methyl-1,2-oxazol-3-yl)carbamoyl-pentylamino]phenoxy]propanoate |
| SMILES | CCCCCN(C(=O)Nc1cc(C)on1)c1ccc(OC(C)(C)C(=O)OCC)cc1 |
| InChI | InChI=1S/C22H31N3O5/c1-6-8-9-14-25(21(27)23-19-15-16(3)30-24-19)17-10-12-18(13-11-17)29-22(4,5)20(26)28-7-2/h10-13,15H,6-9,14H2,1-5H3,(H,23,24,27) |
| InChIKey | ZIIKWDAOBNGXMK-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 93.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|