C29H41BrN2O4 — CID 67686143
ethyl 2-[4-[[[(4-bromo-2,6-dimethylphenyl)-heptylcarbamoyl]amino]methyl]phenoxy]-2-methylpropanoate (PubChem CID 67686143) has the molecular formula C29H41BrN2O4 and a molecular weight of 561.56 g/mol. Its IUPAC name is ethyl 2-[4-[[[(4-bromo-2,6-dimethylphenyl)-heptylcarbamoyl]amino]methyl]phenoxy]-2-methylpropanoate.
| Compound Name | ethyl 2-[4-[[[(4-bromo-2,6-dimethylphenyl)-heptylcarbamoyl]amino]methyl]phenoxy]-2-methylpropanoate |
|---|---|
| PubChem CID | 67686143 |
| Molecular Formula | C29H41BrN2O4 |
| Molecular Weight | 561.56 g/mol |
| Exact Mass | 560.22 |
| IUPAC Name | ethyl 2-[4-[[[(4-bromo-2,6-dimethylphenyl)-heptylcarbamoyl]amino]methyl]phenoxy]-2-methylpropanoate |
| SMILES | CCCCCCCN(C(=O)NCc1ccc(OC(C)(C)C(=O)OCC)cc1)c1c(C)cc(Br)cc1C |
| InChI | InChI=1S/C29H41BrN2O4/c1-7-9-10-11-12-17-32(26-21(3)18-24(30)19-22(26)4)28(34)31-20-23-13-15-25(16-14-23)36-29(5,6)27(33)35-8-2/h13-16,18-19H,7-12,17,20H2,1-6H3,(H,31,34) |
| InChIKey | BMMKEYCVAHRXLV-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.56 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|