C34H42N2O4 — CID 22924121
ethyl 2-[4-[[9H-fluoren-4-ylcarbamoyl(heptyl)amino]methyl]phenoxy]-2-methylpropanoate (PubChem CID 22924121) has the molecular formula C34H42N2O4 and a molecular weight of 542.72 g/mol. Its IUPAC name is ethyl 2-[4-[[9H-fluoren-4-ylcarbamoyl(heptyl)amino]methyl]phenoxy]-2-methylpropanoate.
| Compound Name | ethyl 2-[4-[[9H-fluoren-4-ylcarbamoyl(heptyl)amino]methyl]phenoxy]-2-methylpropanoate |
|---|---|
| PubChem CID | 22924121 |
| Molecular Formula | C34H42N2O4 |
| Molecular Weight | 542.72 g/mol |
| Exact Mass | 542.31 |
| IUPAC Name | ethyl 2-[4-[[9H-fluoren-4-ylcarbamoyl(heptyl)amino]methyl]phenoxy]-2-methylpropanoate |
| SMILES | CCCCCCCN(Cc1ccc(OC(C)(C)C(=O)OCC)cc1)C(=O)Nc1cccc2c1-c1ccccc1C2 |
| InChI | InChI=1S/C34H42N2O4/c1-5-7-8-9-12-22-36(24-25-18-20-28(21-19-25)40-34(3,4)32(37)39-6-2)33(38)35-30-17-13-15-27-23-26-14-10-11-16-29(26)31(27)30/h10-11,13-21H,5-9,12,22-24H2,1-4H3,(H,35,38) |
| InChIKey | QCSKOJTVRFCTJJ-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.72 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|