C40H43N3O4S — CID 15544043
4-tert-butyl-N-[2-[4-[[naphthalen-1-ylcarbamoyl(pentyl)amino]methyl]phenyl]phenyl]sulfonylbenzamide (PubChem CID 15544043) has the molecular formula C40H43N3O4S and a molecular weight of 661.87 g/mol. Its IUPAC name is 4-tert-butyl-N-[2-[4-[[naphthalen-1-ylcarbamoyl(pentyl)amino]methyl]phenyl]phenyl]sulfonylbenzamide.
| Compound Name | 4-tert-butyl-N-[2-[4-[[naphthalen-1-ylcarbamoyl(pentyl)amino]methyl]phenyl]phenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 15544043 |
| Molecular Formula | C40H43N3O4S |
| Molecular Weight | 661.87 g/mol |
| Exact Mass | 661.30 |
| IUPAC Name | 4-tert-butyl-N-[2-[4-[[naphthalen-1-ylcarbamoyl(pentyl)amino]methyl]phenyl]phenyl]sulfonylbenzamide |
| SMILES | CCCCCN(Cc1ccc(-c2ccccc2S(=O)(=O)NC(=O)c2ccc(C(C)(C)C)cc2)cc1)C(=O)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C40H43N3O4S/c1-5-6-11-27-43(39(45)41-36-17-12-14-30-13-7-8-15-34(30)36)28-29-19-21-31(22-20-29)35-16-9-10-18-37(35)48(46,47)42-38(44)32-23-25-33(26-24-32)40(2,3)4/h7-10,12-26H,5-6,11,27-28H2,1-4H3,(H,41,45)(H,42,44) |
| InChIKey | NHBCLGQFZPYKKI-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.87 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|