C33H33Cl2N3O4S — CID 19024483
2-chloro-N-[2-[4-[[[(2-chlorophenyl)-methylcarbamoyl]-pentylamino]methyl]phenyl]phenyl]sulfonylbenzamide (PubChem CID 19024483) has the molecular formula C33H33Cl2N3O4S and a molecular weight of 638.62 g/mol. Its IUPAC name is 2-chloro-N-[2-[4-[[[(2-chlorophenyl)-methylcarbamoyl]-pentylamino]methyl]phenyl]phenyl]sulfonylbenzamide.
| Compound Name | 2-chloro-N-[2-[4-[[[(2-chlorophenyl)-methylcarbamoyl]-pentylamino]methyl]phenyl]phenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 19024483 |
| Molecular Formula | C33H33Cl2N3O4S |
| Molecular Weight | 638.62 g/mol |
| Exact Mass | 637.16 |
| IUPAC Name | 2-chloro-N-[2-[4-[[[(2-chlorophenyl)-methylcarbamoyl]-pentylamino]methyl]phenyl]phenyl]sulfonylbenzamide |
| SMILES | CCCCCN(Cc1ccc(-c2ccccc2S(=O)(=O)NC(=O)c2ccccc2Cl)cc1)C(=O)N(C)c1ccccc1Cl |
| InChI | InChI=1S/C33H33Cl2N3O4S/c1-3-4-11-22-38(33(40)37(2)30-16-9-8-15-29(30)35)23-24-18-20-25(21-19-24)26-12-6-10-17-31(26)43(41,42)36-32(39)27-13-5-7-14-28(27)34/h5-10,12-21H,3-4,11,22-23H2,1-2H3,(H,36,39) |
| InChIKey | UPMBQIMTAIDRBR-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.62 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|