C38H42Cl2N4O5S — CID 19024430
2-chloro-N-[2-[4-[[[[2-chloro-5-(propanoylamino)phenyl]-methylcarbamoyl]-pentylamino]methyl]phenyl]-4-ethylphenyl]sulfonylbenzamide (PubChem CID 19024430) has the molecular formula C38H42Cl2N4O5S and a molecular weight of 737.75 g/mol. Its IUPAC name is 2-chloro-N-[2-[4-[[[[2-chloro-5-(propanoylamino)phenyl]-methylcarbamoyl]-pentylamino]methyl]phenyl]-4-ethylphenyl]sulfonylbenzamide.
| Compound Name | 2-chloro-N-[2-[4-[[[[2-chloro-5-(propanoylamino)phenyl]-methylcarbamoyl]-pentylamino]methyl]phenyl]-4-ethylphenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 19024430 |
| Molecular Formula | C38H42Cl2N4O5S |
| Molecular Weight | 737.75 g/mol |
| Exact Mass | 736.23 |
| IUPAC Name | 2-chloro-N-[2-[4-[[[[2-chloro-5-(propanoylamino)phenyl]-methylcarbamoyl]-pentylamino]methyl]phenyl]-4-ethylphenyl]sulfonylbenzamide |
| SMILES | CCCCCN(Cc1ccc(-c2cc(CC)ccc2S(=O)(=O)NC(=O)c2ccccc2Cl)cc1)C(=O)N(C)c1cc(NC(=O)CC)ccc1Cl |
| InChI | InChI=1S/C38H42Cl2N4O5S/c1-5-8-11-22-44(38(47)43(4)34-24-29(19-20-33(34)40)41-36(45)7-3)25-27-14-17-28(18-15-27)31-23-26(6-2)16-21-35(31)50(48,49)42-37(46)30-12-9-10-13-32(30)39/h9-10,12-21,23-24H,5-8,11,22,25H2,1-4H3,(H,41,45)(H,42,46) |
| InChIKey | XWLQNRUJAFBILS-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.75 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|